C30H36O5 — CID 118465234
2-phenylethyl 6-hydroxy-5-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,4-dioxo-2-pentylcyclohexa-1,5-diene-1-carboxylate (PubChem CID 118465234) has the molecular formula C30H36O5 and a molecular weight of 476.61 g/mol. Its IUPAC name is 2-phenylethyl 6-hydroxy-5-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,4-dioxo-2-pentylcyclohexa-1,5-diene-1-carboxylate.
| Compound Name | 2-phenylethyl 6-hydroxy-5-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,4-dioxo-2-pentylcyclohexa-1,5-diene-1-carboxylate |
|---|---|
| PubChem CID | 118465234 |
| Molecular Formula | C30H36O5 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 2-phenylethyl 6-hydroxy-5-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,4-dioxo-2-pentylcyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1C1=C(O)C(C(=O)OCCc2ccccc2)=C(CCCCC)C(=O)C1=O |
| InChI | InChI=1S/C30H36O5/c1-5-6-8-13-23-26(30(34)35-17-16-21-11-9-7-10-12-21)28(32)25(29(33)27(23)31)24-18-20(4)14-15-22(24)19(2)3/h7,9-12,18,22,24,32H,2,5-6,8,13-17H2,1,3-4H3/t22-,24+/m0/s1 |
| InChIKey | PXQUJLGQMJZQOQ-LADGPHEKSA-N |
| XLogP | 6.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|