C29H34O4 — CID 118465383
2-phenylethyl (6aR,10aR)-1-hydroxy-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylate (PubChem CID 118465383) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-phenylethyl (6aR,10aR)-1-hydroxy-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylate.
| Compound Name | 2-phenylethyl (6aR,10aR)-1-hydroxy-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 118465383 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2-phenylethyl (6aR,10aR)-1-hydroxy-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carboxylate |
| SMILES | C=C1Oc2cc(CCCCC)c(C(=O)OCCc3ccccc3)c(O)c2[C@@H]2C=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C29H34O4/c1-4-5-7-12-22-18-25-27(24-17-19(2)13-14-23(24)20(3)33-25)28(30)26(22)29(31)32-16-15-21-10-8-6-9-11-21/h6,8-11,17-18,23-24,30H,3-5,7,12-16H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | MSHMJAOAOJGZOO-BJKOFHAPSA-N |
| XLogP | 6.87 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|