C23H24O2 — CID 156871656
(6aR,10aS)-9-methyl-6-methylidene-3-(2-phenylethyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 156871656) has the molecular formula C23H24O2 and a molecular weight of 332.44 g/mol. Its IUPAC name is (6aR,10aS)-9-methyl-6-methylidene-3-(2-phenylethyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aS)-9-methyl-6-methylidene-3-(2-phenylethyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 156871656 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (6aR,10aS)-9-methyl-6-methylidene-3-(2-phenylethyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | C=C1Oc2cc(CCc3ccccc3)cc(O)c2[C@H]2C=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C23H24O2/c1-15-8-11-19-16(2)25-22-14-18(10-9-17-6-4-3-5-7-17)13-21(24)23(22)20(19)12-15/h3-7,12-14,19-20,24H,2,8-11H2,1H3/t19-,20-/m0/s1 |
| InChIKey | YUWNDTNRGIWEGD-PMACEKPBSA-N |
| XLogP | 5.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|