C25H35NO4 — CID 89180842
[(6aR,10aR)-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 4-aminobutyl carbonate (PubChem CID 89180842) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is [(6aR,10aR)-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 4-aminobutyl carbonate.
| Compound Name | [(6aR,10aR)-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 4-aminobutyl carbonate |
|---|---|
| PubChem CID | 89180842 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | [(6aR,10aR)-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 4-aminobutyl carbonate |
| SMILES | C=C1Oc2cc(CCCCC)cc(OC(=O)OCCCCN)c2[C@@H]2C=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C25H35NO4/c1-4-5-6-9-19-15-22-24(21-14-17(2)10-11-20(21)18(3)29-22)23(16-19)30-25(27)28-13-8-7-12-26/h14-16,20-21H,3-13,26H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | FWHMHZPPVNKPTI-LEWJYISDSA-N |
| XLogP | 6.02 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|