C22H29NO3 — CID 89180987
[(6aR,10aR)-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-aminoacetate (PubChem CID 89180987) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is [(6aR,10aR)-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-aminoacetate.
| Compound Name | [(6aR,10aR)-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 89180987 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [(6aR,10aR)-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-aminoacetate |
| SMILES | C=C1Oc2cc(CCCCC)cc(OC(=O)CN)c2[C@@H]2C=C(C)CC[C@@H]12 |
| InChI | InChI=1S/C22H29NO3/c1-4-5-6-7-16-11-19-22(20(12-16)26-21(24)13-23)18-10-14(2)8-9-17(18)15(3)25-19/h10-12,17-18H,3-9,13,23H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | KDSKWTXSUPPOFD-ZWKOTPCHSA-N |
| XLogP | 4.63 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|