C24H34O5 — CID 143815458
(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) (2S)-2,3-dihydroxypropanoate (PubChem CID 143815458) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) (2S)-2,3-dihydroxypropanoate.
| Compound Name | (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) (2S)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 143815458 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) (2S)-2,3-dihydroxypropanoate |
| SMILES | CCCCCc1cc(OC(=O)[C@@H](O)CO)c2c(c1)OC(C)(C)C1CCC(C)=CC21 |
| InChI | InChI=1S/C24H34O5/c1-5-6-7-8-16-12-20(28-23(27)19(26)14-25)22-17-11-15(2)9-10-18(17)24(3,4)29-21(22)13-16/h11-13,17-19,25-26H,5-10,14H2,1-4H3/t17?,18?,19-/m0/s1 |
| InChIKey | WUPURSKTAUGQRZ-ACBHZAAOSA-N |
| XLogP | 4.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|