C26H38N2O3 — CID 165400449
[(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] piperazine-1-carboxylate (PubChem CID 165400449) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] piperazine-1-carboxylate.
| Compound Name | [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 165400449 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] piperazine-1-carboxylate |
| SMILES | CCCCCc1cc(OC(=O)N2CCNCC2)c2c(c1)OC(C)(C)[C@@H]1CCC(C)=CC21 |
| InChI | InChI=1S/C26H38N2O3/c1-5-6-7-8-19-16-22(30-25(29)28-13-11-27-12-14-28)24-20-15-18(2)9-10-21(20)26(3,4)31-23(24)17-19/h15-17,20-21,27H,5-14H2,1-4H3/t20?,21-/m1/s1 |
| InChIKey | SLRHOTZNXOGUBS-BPGUCPLFSA-N |
| XLogP | 5.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|