C31H41NO4 — CID 163764756
(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) 4-[4-(hydroxyamino)phenyl]butanoate (PubChem CID 163764756) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) 4-[4-(hydroxyamino)phenyl]butanoate.
| Compound Name | (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) 4-[4-(hydroxyamino)phenyl]butanoate |
|---|---|
| PubChem CID | 163764756 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) 4-[4-(hydroxyamino)phenyl]butanoate |
| SMILES | CCCCCc1cc(OC(=O)CCCc2ccc(NO)cc2)c2c(c1)OC(C)(C)C1CCC(C)=CC21 |
| InChI | InChI=1S/C31H41NO4/c1-5-6-7-9-23-19-27(35-29(33)11-8-10-22-13-15-24(32-34)16-14-22)30-25-18-21(2)12-17-26(25)31(3,4)36-28(30)20-23/h13-16,18-20,25-26,32,34H,5-12,17H2,1-4H3 |
| InChIKey | MBHAHWLUABJHMH-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|