C26H38O5 — CID 146691855
[(10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate (PubChem CID 146691855) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is [(10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate.
| Compound Name | [(10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 146691855 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | [(10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
| SMILES | CCCCCc1cc(OC(=O)C(C)(CO)CO)c2c(c1)OC(C)(C)C1CCC(C)=C[C@@H]21 |
| InChI | InChI=1S/C26H38O5/c1-6-7-8-9-18-13-21(30-24(29)26(5,15-27)16-28)23-19-12-17(2)10-11-20(19)25(3,4)31-22(23)14-18/h12-14,19-20,27-28H,6-11,15-16H2,1-5H3/t19-,20?/m1/s1 |
| InChIKey | QITUEBBJIVUDPA-FIWHBWSRSA-N |
| XLogP | 4.93 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|