C24H38O2Si — CID 91746625
[(6aS,10aS)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy-trimethylsilane (PubChem CID 91746625) has the molecular formula C24H38O2Si and a molecular weight of 386.65 g/mol. Its IUPAC name is [(6aS,10aS)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy-trimethylsilane.
| Compound Name | [(6aS,10aS)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91746625 |
| Molecular Formula | C24H38O2Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | [(6aS,10aS)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl]oxy-trimethylsilane |
| SMILES | CCCCCc1cc2c(c(O[Si](C)(C)C)c1)[C@H]1C=C(C)CC[C@@H]1C(C)(C)O2 |
| InChI | InChI=1S/C24H38O2Si/c1-8-9-10-11-18-15-21-23(22(16-18)26-27(5,6)7)19-14-17(2)12-13-20(19)24(3,4)25-21/h14-16,19-20H,8-13H2,1-7H3/t19-,20-/m0/s1 |
| InChIKey | JFPSLJJGWCHYOE-PMACEKPBSA-N |
| XLogP | 7.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|