C28H44O2Si — CID 633996
(3-heptyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy-dimethyl-prop-2-enylsilane (PubChem CID 633996) has the molecular formula C28H44O2Si and a molecular weight of 440.74 g/mol. Its IUPAC name is (3-heptyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy-dimethyl-prop-2-enylsilane.
| Compound Name | (3-heptyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy-dimethyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 633996 |
| Molecular Formula | C28H44O2Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | (3-heptyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy-dimethyl-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)Oc1cc(CCCCCCC)cc2c1C1C=C(C)CCC1C(C)(C)O2 |
| InChI | InChI=1S/C28H44O2Si/c1-8-10-11-12-13-14-22-19-25-27(26(20-22)30-31(6,7)17-9-2)23-18-21(3)15-16-24(23)28(4,5)29-25/h9,18-20,23-24H,2,8,10-17H2,1,3-7H3 |
| InChIKey | AAVBSMFDWCNRQH-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|