C32H52N2O3 — CID 165400448
[(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] piperazine-1-carboxylate;ethane;2-methylprop-1-ene (PubChem CID 165400448) has the molecular formula C32H52N2O3 and a molecular weight of 512.78 g/mol. Its IUPAC name is [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] piperazine-1-carboxylate;ethane;2-methylprop-1-ene.
| Compound Name | [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] piperazine-1-carboxylate;ethane;2-methylprop-1-ene |
|---|---|
| PubChem CID | 165400448 |
| Molecular Formula | C32H52N2O3 |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 512.40 |
| IUPAC Name | [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] piperazine-1-carboxylate;ethane;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC.CCCCCc1cc(OC(=O)N2CCNCC2)c2c(c1)OC(C)(C)[C@@H]1CCC(C)=CC21 |
| InChI | InChI=1S/C26H38N2O3.C4H8.C2H6/c1-5-6-7-8-19-16-22(30-25(29)28-13-11-27-12-14-28)24-20-15-18(2)9-10-21(20)26(3,4)31-23(24)17-19;1-4(2)3;1-2/h15-17,20-21,27H,5-14H2,1-4H3;1H2,2-3H3;1-2H3/t20?,21-;;/m1../s1 |
| InChIKey | HHMYGAHTQPUZLC-VTNGURIGSA-N |
| XLogP | 8.04 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|