C25H36O6 — CID 118198467
[(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] [(2R)-2,3-dihydroxypropyl] carbonate (PubChem CID 118198467) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] [(2R)-2,3-dihydroxypropyl] carbonate.
| Compound Name | [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] [(2R)-2,3-dihydroxypropyl] carbonate |
|---|---|
| PubChem CID | 118198467 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [(6aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] [(2R)-2,3-dihydroxypropyl] carbonate |
| SMILES | CCCCCc1cc(OC(=O)OC[C@H](O)CO)c2c(c1)OC(C)(C)[C@@H]1CCC(C)=CC21 |
| InChI | InChI=1S/C25H36O6/c1-5-6-7-8-17-12-21(30-24(28)29-15-18(27)14-26)23-19-11-16(2)9-10-20(19)25(3,4)31-22(23)13-17/h11-13,18-20,26-27H,5-10,14-15H2,1-4H3/t18-,19?,20-/m1/s1 |
| InChIKey | RZSIKUBQEUKHII-YSSMNDQQSA-N |
| XLogP | 4.90 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|