C26H39NO3 — CID 46190762
(6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) (2S)-2-amino-3-methylbutanoate (PubChem CID 46190762) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) (2S)-2-amino-3-methylbutanoate.
| Compound Name | (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 46190762 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | (6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl) (2S)-2-amino-3-methylbutanoate |
| SMILES | CCCCCc1cc(OC(=O)[C@@H](N)C(C)C)c2c(c1)OC(C)(C)C1CCC(C)=CC21 |
| InChI | InChI=1S/C26H39NO3/c1-7-8-9-10-18-14-21(29-25(28)24(27)16(2)3)23-19-13-17(4)11-12-20(19)26(5,6)30-22(23)15-18/h13-16,19-20,24H,7-12,27H2,1-6H3/t19?,20?,24-/m0/s1 |
| InChIKey | NKEVDTFHDLSGDG-IMQCZEGASA-N |
| XLogP | 5.92 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|