C24H33O6P — CID 155575857
[methyl-[(9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]phosphoryl]oxymethyl acetate (PubChem CID 155575857) has the molecular formula C24H33O6P and a molecular weight of 448.50 g/mol. Its IUPAC name is [methyl-[(9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]phosphoryl]oxymethyl acetate.
| Compound Name | [methyl-[(9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]phosphoryl]oxymethyl acetate |
|---|---|
| PubChem CID | 155575857 |
| Molecular Formula | C24H33O6P |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [methyl-[(9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]phosphoryl]oxymethyl acetate |
| SMILES | C=C1Oc2cc(CCCCC)cc(OP(C)(=O)OCOC(C)=O)c2C2C=C(C)CCC12 |
| InChI | InChI=1S/C24H33O6P/c1-6-7-8-9-19-13-22-24(21-12-16(2)10-11-20(21)17(3)29-22)23(14-19)30-31(5,26)28-15-27-18(4)25/h12-14,20-21H,3,6-11,15H2,1-2,4-5H3 |
| InChIKey | ZPFZXHLPLQOBFR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|