C29H35O4P — CID 155575882
2-[(9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]-4-phenyl-1,3,2-dioxaphosphinane (PubChem CID 155575882) has the molecular formula C29H35O4P and a molecular weight of 478.57 g/mol. Its IUPAC name is 2-[(9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]-4-phenyl-1,3,2-dioxaphosphinane.
| Compound Name | 2-[(9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]-4-phenyl-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 155575882 |
| Molecular Formula | C29H35O4P |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-[(9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl)oxy]-4-phenyl-1,3,2-dioxaphosphinane |
| SMILES | C=C1Oc2cc(CCCCC)cc(OP3OCCC(c4ccccc4)O3)c2C2C=C(C)CCC12 |
| InChI | InChI=1S/C29H35O4P/c1-4-5-7-10-22-18-27-29(25-17-20(2)13-14-24(25)21(3)31-27)28(19-22)33-34-30-16-15-26(32-34)23-11-8-6-9-12-23/h6,8-9,11-12,17-19,24-26H,3-5,7,10,13-16H2,1-2H3 |
| InChIKey | MXIUBWCASUTFAI-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|