C32H39NO2 — CID 155575435
9-methyl-6-methylidene-2-[4-[(Z)-1-methyliminopent-2-en-2-yl]phenyl]-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 155575435) has the molecular formula C32H39NO2 and a molecular weight of 469.67 g/mol. Its IUPAC name is 9-methyl-6-methylidene-2-[4-[(Z)-1-methyliminopent-2-en-2-yl]phenyl]-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 9-methyl-6-methylidene-2-[4-[(Z)-1-methyliminopent-2-en-2-yl]phenyl]-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 155575435 |
| Molecular Formula | C32H39NO2 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | 9-methyl-6-methylidene-2-[4-[(Z)-1-methyliminopent-2-en-2-yl]phenyl]-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | C=C1Oc2cc(CCCCC)c(-c3ccc(C(=C/CC)/C=N/C)cc3)c(O)c2C2C=C(C)CCC12 |
| InChI | InChI=1S/C32H39NO2/c1-6-8-9-11-25-19-29-31(28-18-21(3)12-17-27(28)22(4)35-29)32(34)30(25)24-15-13-23(14-16-24)26(10-7-2)20-33-5/h10,13-16,18-20,27-28,34H,4,6-9,11-12,17H2,1-3,5H3/b26-10+,33-20+ |
| InChIKey | WFJHJBSPHBNQBZ-BOGAPNNGSA-N |
| XLogP | 8.63 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|