C24H33NO3 — CID 156715869
N-[1-(1-hydroxy-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-2-yl)ethyl]acetamide (PubChem CID 156715869) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is N-[1-(1-hydroxy-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-2-yl)ethyl]acetamide.
| Compound Name | N-[1-(1-hydroxy-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 156715869 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | N-[1-(1-hydroxy-9-methyl-6-methylidene-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-2-yl)ethyl]acetamide |
| SMILES | C=C1Oc2cc(CCCCC)c(C(C)NC(C)=O)c(O)c2C2C=C(C)CCC12 |
| InChI | InChI=1S/C24H33NO3/c1-6-7-8-9-18-13-21-23(24(27)22(18)15(3)25-17(5)26)20-12-14(2)10-11-19(20)16(4)28-21/h12-13,15,19-20,27H,4,6-11H2,1-3,5H3,(H,25,26) |
| InChIKey | BOHPYEGMQBBXQD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|