C27H33NO3 — CID 168900312
5-(benzylamino)-4-hydroxy-3-[(1R,5R)-3-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-6-pentylcyclohexa-3,5-diene-1,2-dione (PubChem CID 168900312) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is 5-(benzylamino)-4-hydroxy-3-[(1R,5R)-3-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-6-pentylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 5-(benzylamino)-4-hydroxy-3-[(1R,5R)-3-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-6-pentylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 168900312 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 5-(benzylamino)-4-hydroxy-3-[(1R,5R)-3-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-6-pentylcyclohexa-3,5-diene-1,2-dione |
| SMILES | C=C(C)[C@@H]1CC(C)=C[C@H]1C1=C(O)C(NCc2ccccc2)=C(CCCCC)C(=O)C1=O |
| InChI | InChI=1S/C27H33NO3/c1-5-6-8-13-20-24(28-16-19-11-9-7-10-12-19)26(30)23(27(31)25(20)29)22-15-18(4)14-21(22)17(2)3/h7,9-12,15,21-22,28,30H,2,5-6,8,13-14,16H2,1,3-4H3/t21-,22+/m0/s1 |
| InChIKey | PSKLXDROSFUCKY-FCHUYYIVSA-N |
| XLogP | 5.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|