C20H27IO2 — CID 168900336
4-iodo-2-[(1R,5R)-3-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-5-pentylbenzene-1,3-diol (PubChem CID 168900336) has the molecular formula C20H27IO2 and a molecular weight of 426.34 g/mol. Its IUPAC name is 4-iodo-2-[(1R,5R)-3-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-5-pentylbenzene-1,3-diol.
| Compound Name | 4-iodo-2-[(1R,5R)-3-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 168900336 |
| Molecular Formula | C20H27IO2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 4-iodo-2-[(1R,5R)-3-methyl-5-prop-1-en-2-ylcyclopent-2-en-1-yl]-5-pentylbenzene-1,3-diol |
| SMILES | C=C(C)[C@@H]1CC(C)=C[C@H]1c1c(O)cc(CCCCC)c(I)c1O |
| InChI | InChI=1S/C20H27IO2/c1-5-6-7-8-14-11-17(22)18(20(23)19(14)21)16-10-13(4)9-15(16)12(2)3/h10-11,15-16,22-23H,2,5-9H2,1,3-4H3/t15-,16+/m0/s1 |
| InChIKey | NZVICHYKYHVIOL-JKSUJKDBSA-N |
| XLogP | 6.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|