C20H29NO3 — CID 118465215
5-(ethylamino)-4-hydroxy-3-[(1S)-3-methylcyclohex-2-en-1-yl]-6-pentylcyclohexa-3,5-diene-1,2-dione (PubChem CID 118465215) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 5-(ethylamino)-4-hydroxy-3-[(1S)-3-methylcyclohex-2-en-1-yl]-6-pentylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 5-(ethylamino)-4-hydroxy-3-[(1S)-3-methylcyclohex-2-en-1-yl]-6-pentylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 118465215 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 5-(ethylamino)-4-hydroxy-3-[(1S)-3-methylcyclohex-2-en-1-yl]-6-pentylcyclohexa-3,5-diene-1,2-dione |
| SMILES | CCCCCC1=C(NCC)C(O)=C([C@@H]2C=C(C)CCC2)C(=O)C1=O |
| InChI | InChI=1S/C20H29NO3/c1-4-6-7-11-15-17(21-5-2)19(23)16(20(24)18(15)22)14-10-8-9-13(3)12-14/h12,14,21,23H,4-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | CEZVUHXAKQNLFW-AWEZNQCLSA-N |
| XLogP | 4.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|