C23H30O5 — CID 25007290
2-[2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,6-dioxo-5-pentylcyclohexa-1,4-dien-1-yl]oxyacetic acid (PubChem CID 25007290) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,6-dioxo-5-pentylcyclohexa-1,4-dien-1-yl]oxyacetic acid.
| Compound Name | 2-[2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,6-dioxo-5-pentylcyclohexa-1,4-dien-1-yl]oxyacetic acid |
|---|---|
| PubChem CID | 25007290 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-[2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-3,6-dioxo-5-pentylcyclohexa-1,4-dien-1-yl]oxyacetic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=CC1C1=C(OCC(=O)O)C(=O)C(CCCCC)=CC1=O |
| InChI | InChI=1S/C23H30O5/c1-5-6-7-8-16-12-19(24)21(23(22(16)27)28-13-20(25)26)18-11-15(4)9-10-17(18)14(2)3/h11-12,17-18H,2,5-10,13H2,1,3-4H3,(H,25,26)/t17-,18?/m0/s1 |
| InChIKey | FJRMCOCAEGJNJK-ZENAZSQFSA-N |
| XLogP | 4.55 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|