C21H30O3 — CID 167109490
3,6-dihydroxy-2-[(1R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylcyclohexa-2,4-dien-1-one (PubChem CID 167109490) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is 3,6-dihydroxy-2-[(1R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylcyclohexa-2,4-dien-1-one.
| Compound Name | 3,6-dihydroxy-2-[(1R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 167109490 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 3,6-dihydroxy-2-[(1R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylcyclohexa-2,4-dien-1-one |
| SMILES | C=C(C)C1CCC(C)=C[C@H]1C1=C(O)C=C(CCCCC)C(O)C1=O |
| InChI | InChI=1S/C21H30O3/c1-5-6-7-8-15-12-18(22)19(21(24)20(15)23)17-11-14(4)9-10-16(17)13(2)3/h11-12,16-17,20,22-23H,2,5-10H2,1,3-4H3/t16?,17-,20?/m1/s1 |
| InChIKey | PJPZUUUVLVYLPX-OHTSDLOESA-N |
| XLogP | 4.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|