C24H34N2O3 — CID 165382408
4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylcyclohexa-1,5-diene-1,3-diol (PubChem CID 165382408) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylcyclohexa-1,5-diene-1,3-diol.
| Compound Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylcyclohexa-1,5-diene-1,3-diol |
|---|---|
| PubChem CID | 165382408 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylcyclohexa-1,5-diene-1,3-diol |
| SMILES | C=C(C)C1CCC(C)=CC1C1=C(O)C=C(CCCCC)C(c2nc(C)no2)C1O |
| InChI | InChI=1S/C24H34N2O3/c1-6-7-8-9-17-13-20(27)22(19-12-15(4)10-11-18(19)14(2)3)23(28)21(17)24-25-16(5)26-29-24/h12-13,18-19,21,23,27-28H,2,6-11H2,1,3-5H3 |
| InChIKey | MBQMUGVEWAHSJK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|