C19H30O2 — CID 172579088
ethane;5-methyl-2-[(1S)-3-methylcyclohex-2-en-1-yl]benzene-1,3-diol;prop-1-ene (PubChem CID 172579088) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is ethane;5-methyl-2-[(1S)-3-methylcyclohex-2-en-1-yl]benzene-1,3-diol;prop-1-ene.
| Compound Name | ethane;5-methyl-2-[(1S)-3-methylcyclohex-2-en-1-yl]benzene-1,3-diol;prop-1-ene |
|---|---|
| PubChem CID | 172579088 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | ethane;5-methyl-2-[(1S)-3-methylcyclohex-2-en-1-yl]benzene-1,3-diol;prop-1-ene |
| SMILES | C=CC.CC.CC1=C[C@@H](c2c(O)cc(C)cc2O)CCC1 |
| InChI | InChI=1S/C14H18O2.C3H6.C2H6/c1-9-4-3-5-11(6-9)14-12(15)7-10(2)8-13(14)16;1-3-2;1-2/h6-8,11,15-16H,3-5H2,1-2H3;3H,1H2,2H3;1-2H3/t11-;;/m0../s1 |
| InChIKey | SNTRYQVDLJRPNP-IDMXKUIJSA-N |
| XLogP | 5.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|