C23H35NO3 — CID 172579099
5-ethyl-2-(3-methylcyclohex-2-en-1-yl)-4-(morpholin-4-ylmethyl)benzene-1,3-diol;prop-1-ene (PubChem CID 172579099) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is 5-ethyl-2-(3-methylcyclohex-2-en-1-yl)-4-(morpholin-4-ylmethyl)benzene-1,3-diol;prop-1-ene.
| Compound Name | 5-ethyl-2-(3-methylcyclohex-2-en-1-yl)-4-(morpholin-4-ylmethyl)benzene-1,3-diol;prop-1-ene |
|---|---|
| PubChem CID | 172579099 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 5-ethyl-2-(3-methylcyclohex-2-en-1-yl)-4-(morpholin-4-ylmethyl)benzene-1,3-diol;prop-1-ene |
| SMILES | C=CC.CCc1cc(O)c(C2C=C(C)CCC2)c(O)c1CN1CCOCC1 |
| InChI | InChI=1S/C20H29NO3.C3H6/c1-3-15-12-18(22)19(16-6-4-5-14(2)11-16)20(23)17(15)13-21-7-9-24-10-8-21;1-3-2/h11-12,16,22-23H,3-10,13H2,1-2H3;3H,1H2,2H3 |
| InChIKey | IMFUOJMFHARKIE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|