C17H26N2O4 — CID 71701165
5-(azepan-1-ylmethyl)-4-hydroxy-3-(morpholin-4-ylmethyl)pyran-2-one (PubChem CID 71701165) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 5-(azepan-1-ylmethyl)-4-hydroxy-3-(morpholin-4-ylmethyl)pyran-2-one.
| Compound Name | 5-(azepan-1-ylmethyl)-4-hydroxy-3-(morpholin-4-ylmethyl)pyran-2-one |
|---|---|
| PubChem CID | 71701165 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 5-(azepan-1-ylmethyl)-4-hydroxy-3-(morpholin-4-ylmethyl)pyran-2-one |
| SMILES | O=c1occ(CN2CCCCCC2)c(O)c1CN1CCOCC1 |
| InChI | InChI=1S/C17H26N2O4/c20-16-14(11-18-5-3-1-2-4-6-18)13-23-17(21)15(16)12-19-7-9-22-10-8-19/h13,20H,1-12H2 |
| InChIKey | RIAQKFCLRUMTLO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |