C15H17NO3 — CID 11978440
6-hydroxy-3-(piperidin-1-ylmethyl)chromen-4-one (PubChem CID 11978440) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 6-hydroxy-3-(piperidin-1-ylmethyl)chromen-4-one.
| Compound Name | 6-hydroxy-3-(piperidin-1-ylmethyl)chromen-4-one |
|---|---|
| PubChem CID | 11978440 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 6-hydroxy-3-(piperidin-1-ylmethyl)chromen-4-one |
| SMILES | O=c1c(CN2CCCCC2)coc2ccc(O)cc12 |
| InChI | InChI=1S/C15H17NO3/c17-12-4-5-14-13(8-12)15(18)11(10-19-14)9-16-6-2-1-3-7-16/h4-5,8,10,17H,1-3,6-7,9H2 |
| InChIKey | PTXQBUHROJRNNB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |