C21H22N2O4 — CID 11978332
3-[(4-benzylpiperazin-1-yl)methyl]-6,7-dihydroxychromen-4-one (PubChem CID 11978332) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[(4-benzylpiperazin-1-yl)methyl]-6,7-dihydroxychromen-4-one.
| Compound Name | 3-[(4-benzylpiperazin-1-yl)methyl]-6,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 11978332 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-[(4-benzylpiperazin-1-yl)methyl]-6,7-dihydroxychromen-4-one |
| SMILES | O=c1c(CN2CCN(Cc3ccccc3)CC2)coc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C21H22N2O4/c24-18-10-17-20(11-19(18)25)27-14-16(21(17)26)13-23-8-6-22(7-9-23)12-15-4-2-1-3-5-15/h1-5,10-11,14,24-25H,6-9,12-13H2 |
| InChIKey | UALKEPYUDFGHFM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|