C22H24N2O2 — CID 18860467
1-(4-benzylpiperazin-1-yl)-2-(5-methyl-1-benzofuran-3-yl)ethanone (PubChem CID 18860467) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(5-methyl-1-benzofuran-3-yl)ethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(5-methyl-1-benzofuran-3-yl)ethanone |
|---|---|
| PubChem CID | 18860467 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(5-methyl-1-benzofuran-3-yl)ethanone |
| SMILES | Cc1ccc2occ(CC(=O)N3CCN(Cc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C22H24N2O2/c1-17-7-8-21-20(13-17)19(16-26-21)14-22(25)24-11-9-23(10-12-24)15-18-5-3-2-4-6-18/h2-8,13,16H,9-12,14-15H2,1H3 |
| InChIKey | RVMFWPXXJGNEAT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |