C20H27N3O — CID 110773664
1-(4-benzylpiperazin-1-yl)-2-(1,2,5-trimethylpyrrol-3-yl)ethanone (PubChem CID 110773664) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(1,2,5-trimethylpyrrol-3-yl)ethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(1,2,5-trimethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 110773664 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(1,2,5-trimethylpyrrol-3-yl)ethanone |
| SMILES | Cc1cc(CC(=O)N2CCN(Cc3ccccc3)CC2)c(C)n1C |
| InChI | InChI=1S/C20H27N3O/c1-16-13-19(17(2)21(16)3)14-20(24)23-11-9-22(10-12-23)15-18-7-5-4-6-8-18/h4-8,13H,9-12,14-15H2,1-3H3 |
| InChIKey | JIWJURKMSYFPDZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |