C23H26N2O2 — CID 18859351
1-(4-benzylpiperazin-1-yl)-2-(4,6-dimethyl-1-benzofuran-3-yl)ethanone (PubChem CID 18859351) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(4,6-dimethyl-1-benzofuran-3-yl)ethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(4,6-dimethyl-1-benzofuran-3-yl)ethanone |
|---|---|
| PubChem CID | 18859351 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(4,6-dimethyl-1-benzofuran-3-yl)ethanone |
| SMILES | Cc1cc(C)c2c(CC(=O)N3CCN(Cc4ccccc4)CC3)coc2c1 |
| InChI | InChI=1S/C23H26N2O2/c1-17-12-18(2)23-20(16-27-21(23)13-17)14-22(26)25-10-8-24(9-11-25)15-19-6-4-3-5-7-19/h3-7,12-13,16H,8-11,14-15H2,1-2H3 |
| InChIKey | VRVYTVKBOLANEJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |