C20H23BrN2O — CID 60614765
1-[4-[(3-bromophenyl)methyl]piperazin-1-yl]-2-(2-methylphenyl)ethanone (PubChem CID 60614765) has the molecular formula C20H23BrN2O and a molecular weight of 387.32 g/mol. Its IUPAC name is 1-[4-[(3-bromophenyl)methyl]piperazin-1-yl]-2-(2-methylphenyl)ethanone.
| Compound Name | 1-[4-[(3-bromophenyl)methyl]piperazin-1-yl]-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 60614765 |
| Molecular Formula | C20H23BrN2O |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 1-[4-[(3-bromophenyl)methyl]piperazin-1-yl]-2-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1CC(=O)N1CCN(Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C20H23BrN2O/c1-16-5-2-3-7-18(16)14-20(24)23-11-9-22(10-12-23)15-17-6-4-8-19(21)13-17/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | KAINITGKQYSRPH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |