C23H26N2O3 — CID 31270944
4-[(4-benzyl-1,4-diazepan-1-yl)methyl]-7-hydroxy-8-methylchromen-2-one (PubChem CID 31270944) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-[(4-benzyl-1,4-diazepan-1-yl)methyl]-7-hydroxy-8-methylchromen-2-one.
| Compound Name | 4-[(4-benzyl-1,4-diazepan-1-yl)methyl]-7-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 31270944 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 4-[(4-benzyl-1,4-diazepan-1-yl)methyl]-7-hydroxy-8-methylchromen-2-one |
| SMILES | Cc1c(O)ccc2c(CN3CCCN(Cc4ccccc4)CC3)cc(=O)oc12 |
| InChI | InChI=1S/C23H26N2O3/c1-17-21(26)9-8-20-19(14-22(27)28-23(17)20)16-25-11-5-10-24(12-13-25)15-18-6-3-2-4-7-18/h2-4,6-9,14,26H,5,10-13,15-16H2,1H3 |
| InChIKey | GIMCIDHHNPNMLA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|