C22H21F3N2O5S — CID 32732088
7-hydroxy-8-methyl-4-[[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]chromen-2-one (PubChem CID 32732088) has the molecular formula C22H21F3N2O5S and a molecular weight of 482.48 g/mol. Its IUPAC name is 7-hydroxy-8-methyl-4-[[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 7-hydroxy-8-methyl-4-[[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 32732088 |
| Molecular Formula | C22H21F3N2O5S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 7-hydroxy-8-methyl-4-[[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1c(O)ccc2c(CN3CCN(S(=O)(=O)c4ccc(C(F)(F)F)cc4)CC3)cc(=O)oc12 |
| InChI | InChI=1S/C22H21F3N2O5S/c1-14-19(28)7-6-18-15(12-20(29)32-21(14)18)13-26-8-10-27(11-9-26)33(30,31)17-4-2-16(3-5-17)22(23,24)25/h2-7,12,28H,8-11,13H2,1H3 |
| InChIKey | KUBADRLURBILGB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|