C21H27FN2O4S — CID 27073706
5-tert-butyl-3-[[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methyl]benzene-1,2-diol (PubChem CID 27073706) has the molecular formula C21H27FN2O4S and a molecular weight of 422.52 g/mol. Its IUPAC name is 5-tert-butyl-3-[[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methyl]benzene-1,2-diol.
| Compound Name | 5-tert-butyl-3-[[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 27073706 |
| Molecular Formula | C21H27FN2O4S |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 5-tert-butyl-3-[[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]methyl]benzene-1,2-diol |
| SMILES | CC(C)(C)c1cc(O)c(O)c(CN2CCN(S(=O)(=O)c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C21H27FN2O4S/c1-21(2,3)16-12-15(20(26)19(25)13-16)14-23-8-10-24(11-9-23)29(27,28)18-6-4-17(22)5-7-18/h4-7,12-13,25-26H,8-11,14H2,1-3H3 |
| InChIKey | HSHRTCSWOWSODX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|