C12H17FN2O3S — CID 103947498
4-fluoro-2-[(4-methylsulfonylpiperazin-1-yl)methyl]phenol (PubChem CID 103947498) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-fluoro-2-[(4-methylsulfonylpiperazin-1-yl)methyl]phenol.
| Compound Name | 4-fluoro-2-[(4-methylsulfonylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 103947498 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-fluoro-2-[(4-methylsulfonylpiperazin-1-yl)methyl]phenol |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc(F)ccc2O)CC1 |
| InChI | InChI=1S/C12H17FN2O3S/c1-19(17,18)15-6-4-14(5-7-15)9-10-8-11(13)2-3-12(10)16/h2-3,8,16H,4-7,9H2,1H3 |
| InChIKey | XYPPSINVTLPQBO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|