C14H21FN2O — CID 104872388
4-fluoro-2-[(3,4,5-trimethylpiperazin-1-yl)methyl]phenol (PubChem CID 104872388) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is 4-fluoro-2-[(3,4,5-trimethylpiperazin-1-yl)methyl]phenol.
| Compound Name | 4-fluoro-2-[(3,4,5-trimethylpiperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 104872388 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 4-fluoro-2-[(3,4,5-trimethylpiperazin-1-yl)methyl]phenol |
| SMILES | CC1CN(Cc2cc(F)ccc2O)CC(C)N1C |
| InChI | InChI=1S/C14H21FN2O/c1-10-7-17(8-11(2)16(10)3)9-12-6-13(15)4-5-14(12)18/h4-6,10-11,18H,7-9H2,1-3H3 |
| InChIKey | SVQHQSFDVMEZND-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|