C15H22FNO — CID 103275846
4-fluoro-2-[(2,3,5-trimethylpiperidin-1-yl)methyl]phenol (PubChem CID 103275846) has the molecular formula C15H22FNO and a molecular weight of 251.34 g/mol. Its IUPAC name is 4-fluoro-2-[(2,3,5-trimethylpiperidin-1-yl)methyl]phenol.
| Compound Name | 4-fluoro-2-[(2,3,5-trimethylpiperidin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 103275846 |
| Molecular Formula | C15H22FNO |
| Molecular Weight | 251.34 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 4-fluoro-2-[(2,3,5-trimethylpiperidin-1-yl)methyl]phenol |
| SMILES | CC1CC(C)C(C)N(Cc2cc(F)ccc2O)C1 |
| InChI | InChI=1S/C15H22FNO/c1-10-6-11(2)12(3)17(8-10)9-13-7-14(16)4-5-15(13)18/h4-5,7,10-12,18H,6,8-9H2,1-3H3 |
| InChIKey | IZJJGFALCQGCCC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|