C15H23BFNO2 — CID 114596163
[3-fluoro-5-[(2,3,5-trimethylpiperidin-1-yl)methyl]phenyl]boronic acid (PubChem CID 114596163) has the molecular formula C15H23BFNO2 and a molecular weight of 279.16 g/mol. Its IUPAC name is [3-fluoro-5-[(2,3,5-trimethylpiperidin-1-yl)methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-5-[(2,3,5-trimethylpiperidin-1-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 114596163 |
| Molecular Formula | C15H23BFNO2 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | [3-fluoro-5-[(2,3,5-trimethylpiperidin-1-yl)methyl]phenyl]boronic acid |
| SMILES | CC1CC(C)C(C)N(Cc2cc(F)cc(B(O)O)c2)C1 |
| InChI | InChI=1S/C15H23BFNO2/c1-10-4-11(2)12(3)18(8-10)9-13-5-14(16(19)20)7-15(17)6-13/h5-7,10-12,19-20H,4,8-9H2,1-3H3 |
| InChIKey | OIMMCOUTEFDJDO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|