C15H22BFN2O2 — CID 79700698
[3-fluoro-5-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]phenyl]boronic acid (PubChem CID 79700698) has the molecular formula C15H22BFN2O2 and a molecular weight of 292.16 g/mol. Its IUPAC name is [3-fluoro-5-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-5-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 79700698 |
| Molecular Formula | C15H22BFN2O2 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | [3-fluoro-5-[(9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl)methyl]phenyl]boronic acid |
| SMILES | CN1C2CCC1CN(Cc1cc(F)cc(B(O)O)c1)CC2 |
| InChI | InChI=1S/C15H22BFN2O2/c1-18-14-2-3-15(18)10-19(5-4-14)9-11-6-12(16(20)21)8-13(17)7-11/h6-8,14-15,20-21H,2-5,9-10H2,1H3 |
| InChIKey | FRYLRLSKPMLZKO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|