C13H18FNO2 — CID 113356760
2-[(2,6-dimethylmorpholin-4-yl)methyl]-4-fluorophenol (PubChem CID 113356760) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-[(2,6-dimethylmorpholin-4-yl)methyl]-4-fluorophenol.
| Compound Name | 2-[(2,6-dimethylmorpholin-4-yl)methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 113356760 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-[(2,6-dimethylmorpholin-4-yl)methyl]-4-fluorophenol |
| SMILES | CC1CN(Cc2cc(F)ccc2O)CC(C)O1 |
| InChI | InChI=1S/C13H18FNO2/c1-9-6-15(7-10(2)17-9)8-11-5-12(14)3-4-13(11)16/h3-5,9-10,16H,6-8H2,1-2H3 |
| InChIKey | QLBUXWOMDMSOBN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|