C14H21NO2 — CID 6937591
(2S,6S)-4-[(2-methoxyphenyl)methyl]-2,6-dimethylmorpholine (PubChem CID 6937591) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (2S,6S)-4-[(2-methoxyphenyl)methyl]-2,6-dimethylmorpholine.
| Compound Name | (2S,6S)-4-[(2-methoxyphenyl)methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 6937591 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (2S,6S)-4-[(2-methoxyphenyl)methyl]-2,6-dimethylmorpholine |
| SMILES | COc1ccccc1CN1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C14H21NO2/c1-11-8-15(9-12(2)17-11)10-13-6-4-5-7-14(13)16-3/h4-7,11-12H,8-10H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | WEKGZAWJOBJDGM-RYUDHWBXSA-N |
| XLogP | 2.30 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |