C20H32BNO4 — CID 113249409
4-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,6-dimethylmorpholine (PubChem CID 113249409) has the molecular formula C20H32BNO4 and a molecular weight of 361.29 g/mol. Its IUPAC name is 4-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 113249409 |
| Molecular Formula | C20H32BNO4 |
| Molecular Weight | 361.29 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 4-[[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,6-dimethylmorpholine |
| SMILES | COc1ccc(B2OC(C)(C)C(C)(C)O2)cc1CN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C20H32BNO4/c1-14-11-22(12-15(2)24-14)13-16-10-17(8-9-18(16)23-7)21-25-19(3,4)20(5,6)26-21/h8-10,14-15H,11-13H2,1-7H3 |
| InChIKey | XIDODVZQCGIWJX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|