C19H31BN2O2 — CID 169422713
1-methyl-4-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine (PubChem CID 169422713) has the molecular formula C19H31BN2O2 and a molecular weight of 330.28 g/mol. Its IUPAC name is 1-methyl-4-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine.
| Compound Name | 1-methyl-4-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 169422713 |
| Molecular Formula | C19H31BN2O2 |
| Molecular Weight | 330.28 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 1-methyl-4-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]piperazine |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1CN1CCN(C)CC1 |
| InChI | InChI=1S/C19H31BN2O2/c1-15-7-8-17(20-23-18(2,3)19(4,5)24-20)13-16(15)14-22-11-9-21(6)10-12-22/h7-8,13H,9-12,14H2,1-6H3 |
| InChIKey | UFDLKIFLHIEYMY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|