C24H30BNO6S — CID 166061459
3-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-phenylmethoxy-4H-oxathiazine 2,2-dioxide (PubChem CID 166061459) has the molecular formula C24H30BNO6S and a molecular weight of 471.38 g/mol. Its IUPAC name is 3-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-phenylmethoxy-4H-oxathiazine 2,2-dioxide.
| Compound Name | 3-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-phenylmethoxy-4H-oxathiazine 2,2-dioxide |
|---|---|
| PubChem CID | 166061459 |
| Molecular Formula | C24H30BNO6S |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 3-[[2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-phenylmethoxy-4H-oxathiazine 2,2-dioxide |
| SMILES | Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1CN1CC=C(OCc2ccccc2)OS1(=O)=O |
| InChI | InChI=1S/C24H30BNO6S/c1-18-11-12-21(25-31-23(2,3)24(4,5)32-25)15-20(18)16-26-14-13-22(30-33(26,27)28)29-17-19-9-7-6-8-10-19/h6-13,15H,14,16-17H2,1-5H3 |
| InChIKey | WROXKOIYGRMUMK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|