C25H35BN2O3 — CID 155777364
1-methyl-4-[2-methyl-6-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (PubChem CID 155777364) has the molecular formula C25H35BN2O3 and a molecular weight of 422.38 g/mol. Its IUPAC name is 1-methyl-4-[2-methyl-6-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine.
| Compound Name | 1-methyl-4-[2-methyl-6-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 155777364 |
| Molecular Formula | C25H35BN2O3 |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 1-methyl-4-[2-methyl-6-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(OCc2ccccc2)c1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H35BN2O3/c1-19-16-21(26-30-24(2,3)25(4,5)31-26)17-22(29-18-20-10-8-7-9-11-20)23(19)28-14-12-27(6)13-15-28/h7-11,16-17H,12-15,18H2,1-6H3 |
| InChIKey | SBJWZLQAXFFZGH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|