C27H29BO5 — CID 23090759
benzyl 2-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 23090759) has the molecular formula C27H29BO5 and a molecular weight of 444.34 g/mol. Its IUPAC name is benzyl 2-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | benzyl 2-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 23090759 |
| Molecular Formula | C27H29BO5 |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | benzyl 2-phenylmethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CC1(C)OB(c2ccc(C(=O)OCc3ccccc3)c(OCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C27H29BO5/c1-26(2)27(3,4)33-28(32-26)22-15-16-23(25(29)31-19-21-13-9-6-10-14-21)24(17-22)30-18-20-11-7-5-8-12-20/h5-17H,18-19H2,1-4H3 |
| InChIKey | SGIABFDBDCXSCX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|