C18H21BO4S — CID 165115895
benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (PubChem CID 165115895) has the molecular formula C18H21BO4S and a molecular weight of 344.24 g/mol. Its IUPAC name is benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate.
| Compound Name | benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 165115895 |
| Molecular Formula | C18H21BO4S |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | benzyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| SMILES | CC1(C)OB(c2csc(C(=O)OCc3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C18H21BO4S/c1-17(2)18(3,4)23-19(22-17)14-10-15(24-12-14)16(20)21-11-13-8-6-5-7-9-13/h5-10,12H,11H2,1-4H3 |
| InChIKey | DYECWJQPEHRQLP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|