C22H24BNO4S — CID 167718191
benzyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophen-5-yl]carbamate (PubChem CID 167718191) has the molecular formula C22H24BNO4S and a molecular weight of 409.32 g/mol. Its IUPAC name is benzyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophen-5-yl]carbamate.
| Compound Name | benzyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophen-5-yl]carbamate |
|---|---|
| PubChem CID | 167718191 |
| Molecular Formula | C22H24BNO4S |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | benzyl N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophen-5-yl]carbamate |
| SMILES | CC1(C)OB(c2csc3ccc(NC(=O)OCc4ccccc4)cc23)OC1(C)C |
| InChI | InChI=1S/C22H24BNO4S/c1-21(2)22(3,4)28-23(27-21)18-14-29-19-11-10-16(12-17(18)19)24-20(25)26-13-15-8-6-5-7-9-15/h5-12,14H,13H2,1-4H3,(H,24,25) |
| InChIKey | RGRAKSRFQROELC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|